C26H30N2O2 — CID 125123969
(3R)-1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-naphthalen-1-yl-3-pyrrol-1-ylpropan-1-one (PubChem CID 125123969) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is (3R)-1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-naphthalen-1-yl-3-pyrrol-1-ylpropan-1-one.
| Compound Name | (3R)-1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-naphthalen-1-yl-3-pyrrol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 125123969 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (3R)-1-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-naphthalen-1-yl-3-pyrrol-1-ylpropan-1-one |
| SMILES | O=C(C[C@H](c1cccc2ccccc12)n1cccc1)N1CC[C@@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C26H30N2O2/c29-25(28-17-14-26(30)13-4-3-10-21(26)19-28)18-24(27-15-5-6-16-27)23-12-7-9-20-8-1-2-11-22(20)23/h1-2,5-9,11-12,15-16,21,24,30H,3-4,10,13-14,17-19H2/t21-,24+,26-/m0/s1 |
| InChIKey | QOWFWBDEKGRBJK-NZJKTDFXSA-N |
| XLogP | 4.77 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |