C19H23N3O3 — CID 95394967
2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]phthalazin-1-one (PubChem CID 95394967) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]phthalazin-1-one.
| Compound Name | 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 95394967 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]phthalazin-1-one |
| SMILES | O=C(Cn1ncc2ccccc2c1=O)N1CC[C@@]2(O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C19H23N3O3/c23-17(21-10-9-19(25)8-4-3-6-15(19)12-21)13-22-18(24)16-7-2-1-5-14(16)11-20-22/h1-2,5,7,11,15,25H,3-4,6,8-10,12-13H2/t15-,19+/m1/s1 |
| InChIKey | FGHUPLJIYWVYKA-BEFAXECRSA-N |
| XLogP | 1.55 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |