C19H23N3O4 — CID 56723869
2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(furan-2-yl)pyridazin-3-one (PubChem CID 56723869) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(furan-2-yl)pyridazin-3-one.
| Compound Name | 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(furan-2-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 56723869 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 2-[2-[(4aS,8aS)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-6-(furan-2-yl)pyridazin-3-one |
| SMILES | O=C(Cn1nc(-c2ccco2)ccc1=O)N1CC[C@@]2(O)CCCC[C@H]2C1 |
| InChI | InChI=1S/C19H23N3O4/c23-17-7-6-15(16-5-3-11-26-16)20-22(17)13-18(24)21-10-9-19(25)8-2-1-4-14(19)12-21/h3,5-7,11,14,25H,1-2,4,8-10,12-13H2/t14-,19-/m0/s1 |
| InChIKey | JPARRBBIBLFFGL-LIRRHRJNSA-N |
| XLogP | 1.66 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |