C19H22N4O4 — CID 95797593
6-(furan-2-yl)-2-[(3R)-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidin-3-yl]pyridazin-3-one (PubChem CID 95797593) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 6-(furan-2-yl)-2-[(3R)-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidin-3-yl]pyridazin-3-one.
| Compound Name | 6-(furan-2-yl)-2-[(3R)-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidin-3-yl]pyridazin-3-one |
|---|---|
| PubChem CID | 95797593 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 6-(furan-2-yl)-2-[(3R)-1-[2-(2-oxopyrrolidin-1-yl)acetyl]piperidin-3-yl]pyridazin-3-one |
| SMILES | O=C1CCCN1CC(=O)N1CCC[C@@H](n2nc(-c3ccco3)ccc2=O)C1 |
| InChI | InChI=1S/C19H22N4O4/c24-17-6-2-10-22(17)13-19(26)21-9-1-4-14(12-21)23-18(25)8-7-15(20-23)16-5-3-11-27-16/h3,5,7-8,11,14H,1-2,4,6,9-10,12-13H2/t14-/m1/s1 |
| InChIKey | KTYBZLFHFRLGHC-CQSZACIVSA-N |
| XLogP | 1.29 |
| TPSA | 88.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |