C21H27N3O5 — CID 124646173
2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one (PubChem CID 124646173) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one.
| Compound Name | 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 124646173 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 2-[2-[(4aS,8aR)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-2-oxoethyl]-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(CC(=O)N3CC[C@@]4(O)CCCC[C@@H]4C3)c(=O)c2c1OC |
| InChI | InChI=1S/C21H27N3O5/c1-28-16-7-6-14-11-22-24(20(26)18(14)19(16)29-2)13-17(25)23-10-9-21(27)8-4-3-5-15(21)12-23/h6-7,11,15,27H,3-5,8-10,12-13H2,1-2H3/t15-,21+/m1/s1 |
| InChIKey | BSZRJQSNYQVRST-VFNWGFHPSA-N |
| XLogP | 1.57 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |