C13H14N2O5 — CID 45490728
methyl 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetate (PubChem CID 45490728) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is methyl 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetate.
| Compound Name | methyl 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetate |
|---|---|
| PubChem CID | 45490728 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetate |
| SMILES | COC(=O)Cn1ncc2ccc(OC)c(OC)c2c1=O |
| InChI | InChI=1S/C13H14N2O5/c1-18-9-5-4-8-6-14-15(7-10(16)19-2)13(17)11(8)12(9)20-3/h4-6H,7H2,1-3H3 |
| InChIKey | IRRFQOVGKSDKNE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |