C18H16ClN3O4 — CID 39354909
N-(4-chlorophenyl)-2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetamide (PubChem CID 39354909) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetamide |
|---|---|
| PubChem CID | 39354909 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(7,8-dimethoxy-1-oxophthalazin-2-yl)acetamide |
| SMILES | COc1ccc2cnn(CC(=O)Nc3ccc(Cl)cc3)c(=O)c2c1OC |
| InChI | InChI=1S/C18H16ClN3O4/c1-25-14-8-3-11-9-20-22(18(24)16(11)17(14)26-2)10-15(23)21-13-6-4-12(19)5-7-13/h3-9H,10H2,1-2H3,(H,21,23) |
| InChIKey | WMAICGBKGGTCHC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |