C17H16N4O4 — CID 71705829
2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide (PubChem CID 71705829) has the molecular formula C17H16N4O4 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide.
| Compound Name | 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 71705829 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide |
| SMILES | COc1ccc2cnn(CC(=O)Nc3ccccn3)c(=O)c2c1OC |
| InChI | InChI=1S/C17H16N4O4/c1-24-12-7-6-11-9-19-21(17(23)15(11)16(12)25-2)10-14(22)20-13-5-3-4-8-18-13/h3-9H,10H2,1-2H3,(H,18,20,22) |
| InChIKey | HUCHRZFKGMJTNV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |