About 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide
2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide (PubChem CID 71705829) has the molecular formula C17H16N4O4
and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide |
| PubChem CID | 71705829 |
| Molecular Formula | C17H16N4O4 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide |
| SMILES | COc1ccc2cnn(CC(=O)Nc3ccccn3)c(=O)c2c1OC |
| InChI | InChI=1S/C17H16N4O4/c1-24-12-7-6-11-9-19-21(17(23)15(11)16(12)25-2)10-14(22)20-13-5-3-4-8-18-13/h3-9H,10H2,1-2H3,(H,18,20,22) |
| InChIKey | HUCHRZFKGMJTNV-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide?
The IUPAC name of 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide (CID 71705829) is 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide.
What is the SMILES notation for 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide?
The canonical SMILES for 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide is COc1ccc2cnn(CC(=O)Nc3ccccn3)c(=O)c2c1OC.
What is the InChIKey of 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide?
The InChIKey is HUCHRZFKGMJTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N4O4/c1-24-12-7-6-11-9-19-21(17(23)15(11)16(12)25-2)10-14(22)20-13-5-3-4-8-18-13/h3-9H,10H2,1-2H3,(H,18,20,22).
What are the key properties of 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide?
2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide has a molecular weight of 340.34 g/mol, XLogP of 1.45, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,8-dimethoxy-1-oxophthalazin-2-yl)-N-pyridin-2-ylacetamide is sourced from PubChem (CID 71705829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).