C17H21N3O4 — CID 95722112
2-[2-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-2-oxoethyl]phthalazin-1-one (PubChem CID 95722112) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 2-[2-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-2-oxoethyl]phthalazin-1-one.
| Compound Name | 2-[2-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-2-oxoethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 95722112 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[2-[(4S)-4-hydroxy-4-(hydroxymethyl)azepan-1-yl]-2-oxoethyl]phthalazin-1-one |
| SMILES | O=C(Cn1ncc2ccccc2c1=O)N1CCC[C@@](O)(CO)CC1 |
| InChI | InChI=1S/C17H21N3O4/c21-12-17(24)6-3-8-19(9-7-17)15(22)11-20-16(23)14-5-2-1-4-13(14)10-18-20/h1-2,4-5,10,21,24H,3,6-9,11-12H2/t17-/m0/s1 |
| InChIKey | DSXHDJJICHATDL-KRWDZBQOSA-N |
| XLogP | 0.13 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |