C19H20N6O3 — CID 154570778
2-[2-(3-methylspiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-1'-yl)-2-oxoethyl]phthalazin-1-one (PubChem CID 154570778) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 2-[2-(3-methylspiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-1'-yl)-2-oxoethyl]phthalazin-1-one.
| Compound Name | 2-[2-(3-methylspiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-1'-yl)-2-oxoethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 154570778 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[2-(3-methylspiro[5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazine-6,3'-pyrrolidine]-1'-yl)-2-oxoethyl]phthalazin-1-one |
| SMILES | Cc1nnc2n1CC1(CCN(C(=O)Cn3ncc4ccccc4c3=O)C1)OC2 |
| InChI | InChI=1S/C19H20N6O3/c1-13-21-22-16-10-28-19(12-24(13)16)6-7-23(11-19)17(26)9-25-18(27)15-5-3-2-4-14(15)8-20-25/h2-5,8H,6-7,9-12H2,1H3 |
| InChIKey | YPIGEQBDEFDKNN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 95.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |