C21H32N2O4 — CID 102564849
3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1-(3-methoxypropyl)-4,6-dimethylpyridin-2-one (PubChem CID 102564849) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1-(3-methoxypropyl)-4,6-dimethylpyridin-2-one.
| Compound Name | 3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1-(3-methoxypropyl)-4,6-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 102564849 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 3-(4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinoline-2-carbonyl)-1-(3-methoxypropyl)-4,6-dimethylpyridin-2-one |
| SMILES | COCCCn1c(C)cc(C)c(C(=O)N2CCC3(O)CCCCC3C2)c1=O |
| InChI | InChI=1S/C21H32N2O4/c1-15-13-16(2)23(10-6-12-27-3)20(25)18(15)19(24)22-11-9-21(26)8-5-4-7-17(21)14-22/h13,17,26H,4-12,14H2,1-3H3 |
| InChIKey | DLNKKEDUTKWTDB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|