C15H17N3O5 — CID 91822490
methyl 2-[3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoylamino]acetate (PubChem CID 91822490) has the molecular formula C15H17N3O5 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 2-[3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoylamino]acetate.
| Compound Name | methyl 2-[3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoylamino]acetate |
|---|---|
| PubChem CID | 91822490 |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | methyl 2-[3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoylamino]acetate |
| SMILES | COC(=O)CNC(=O)CCC1NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C15H17N3O5/c1-23-13(20)9-16-12(19)8-7-11-14(21)18(15(22)17-11)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,16,19)(H,17,22) |
| InChIKey | OSHGYHFBMLSBFG-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|