C16H21ClN4O3 — CID 119630707
N-(2-amino-2-methylpropyl)-3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide (PubChem CID 119630707) has the molecular formula C16H21ClN4O3 and a molecular weight of 352.82 g/mol. Its IUPAC name is N-(2-amino-2-methylpropyl)-3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide.
| Compound Name | N-(2-amino-2-methylpropyl)-3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
|---|---|
| PubChem CID | 119630707 |
| Molecular Formula | C16H21ClN4O3 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-(2-amino-2-methylpropyl)-3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanamide |
| SMILES | CC(C)(N)CNC(=O)CCC1NC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C16H21ClN4O3/c1-16(2,18)9-19-13(22)8-7-12-14(23)21(15(24)20-12)11-5-3-10(17)4-6-11/h3-6,12H,7-9,18H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | GOMVLJNEZCRVPW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|