C18H22ClN3O5 — CID 119362153
(2S)-2-[3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoylamino]-4-methylpentanoic acid (PubChem CID 119362153) has the molecular formula C18H22ClN3O5 and a molecular weight of 395.84 g/mol. Its IUPAC name is (2S)-2-[3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119362153 |
| Molecular Formula | C18H22ClN3O5 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | (2S)-2-[3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCC1NC(=O)N(c2ccc(Cl)cc2)C1=O)C(=O)O |
| InChI | InChI=1S/C18H22ClN3O5/c1-10(2)9-14(17(25)26)20-15(23)8-7-13-16(24)22(18(27)21-13)12-5-3-11(19)4-6-12/h3-6,10,13-14H,7-9H2,1-2H3,(H,20,23)(H,21,27)(H,25,26)/t13?,14-/m0/s1 |
| InChIKey | JLOXOLUYGMAWIY-KZUDCZAMSA-N |
| XLogP | 2.16 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|