C13H14N2O4 — CID 164674956
methyl 3-[(4R)-2,5-dioxo-1-phenylimidazolidin-4-yl]propanoate (PubChem CID 164674956) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is methyl 3-[(4R)-2,5-dioxo-1-phenylimidazolidin-4-yl]propanoate.
| Compound Name | methyl 3-[(4R)-2,5-dioxo-1-phenylimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 164674956 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | methyl 3-[(4R)-2,5-dioxo-1-phenylimidazolidin-4-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1NC(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C13H14N2O4/c1-19-11(16)8-7-10-12(17)15(13(18)14-10)9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3,(H,14,18)/t10-/m1/s1 |
| InChIKey | CHQKIEDJHFDGSI-SNVBAGLBSA-N |
| XLogP | 1.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|