C12H13N3O2S — CID 3034583
3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanamide (PubChem CID 3034583) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanamide.
| Compound Name | 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanamide |
|---|---|
| PubChem CID | 3034583 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(5-oxo-1-phenyl-2-sulfanylideneimidazolidin-4-yl)propanamide |
| SMILES | NC(=O)CCC1NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H13N3O2S/c13-10(16)7-6-9-11(17)15(12(18)14-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H2,13,16)(H,14,18) |
| InChIKey | UNCINZHSIAEDPO-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|