C14H15N2O3S- — CID 4275803
3-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate (PubChem CID 4275803) has the molecular formula C14H15N2O3S- and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate.
| Compound Name | 3-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 4275803 |
| Molecular Formula | C14H15N2O3S- |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-[1-(3,4-dimethylphenyl)-5-oxo-2-sulfanylideneimidazolidin-4-yl]propanoate |
| SMILES | Cc1ccc(N2C(=O)C(CCC(=O)[O-])NC2=S)cc1C |
| InChI | InChI=1S/C14H16N2O3S/c1-8-3-4-10(7-9(8)2)16-13(19)11(15-14(16)20)5-6-12(17)18/h3-4,7,11H,5-6H2,1-2H3,(H,15,20)(H,17,18)/p-1 |
| InChIKey | BHSBUYBGKVVWDH-UHFFFAOYSA-M |
| XLogP | 0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|