C16H17F3N2O5 — CID 167828767
methyl 3-[(4R)-1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 167828767) has the molecular formula C16H17F3N2O5 and a molecular weight of 374.32 g/mol. Its IUPAC name is methyl 3-[(4R)-1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | methyl 3-[(4R)-1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 167828767 |
| Molecular Formula | C16H17F3N2O5 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | methyl 3-[(4R)-1-[3-methyl-4-(2,2,2-trifluoroethoxy)phenyl]-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | COC(=O)CC[C@H]1NC(=O)N(c2ccc(OCC(F)(F)F)c(C)c2)C1=O |
| InChI | InChI=1S/C16H17F3N2O5/c1-9-7-10(3-5-12(9)26-8-16(17,18)19)21-14(23)11(20-15(21)24)4-6-13(22)25-2/h3,5,7,11H,4,6,8H2,1-2H3,(H,20,24)/t11-/m1/s1 |
| InChIKey | VBQOYBDUSPKTNX-LLVKDONJSA-N |
| XLogP | 2.31 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|