C22H19F3N6O4 — CID 154860110
[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl 3-[1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 154860110) has the molecular formula C22H19F3N6O4 and a molecular weight of 488.43 g/mol. Its IUPAC name is [1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl 3-[1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | [1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl 3-[1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 154860110 |
| Molecular Formula | C22H19F3N6O4 |
| Molecular Weight | 488.43 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl 3-[1-(3-methylphenyl)-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | Cc1cccc(N2C(=O)NC(CCC(=O)OCc3nnnn3-c3ccc(C(F)(F)F)cc3)C2=O)c1 |
| InChI | InChI=1S/C22H19F3N6O4/c1-13-3-2-4-16(11-13)30-20(33)17(26-21(30)34)9-10-19(32)35-12-18-27-28-29-31(18)15-7-5-14(6-8-15)22(23,24)25/h2-8,11,17H,9-10,12H2,1H3,(H,26,34) |
| InChIKey | KGBYMGIJPOMJSN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|