C17H15F3N6O — CID 87029571
2-methyl-6-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methylamino]benzamide (PubChem CID 87029571) has the molecular formula C17H15F3N6O and a molecular weight of 376.34 g/mol. Its IUPAC name is 2-methyl-6-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methylamino]benzamide.
| Compound Name | 2-methyl-6-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methylamino]benzamide |
|---|---|
| PubChem CID | 87029571 |
| Molecular Formula | C17H15F3N6O |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 2-methyl-6-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methylamino]benzamide |
| SMILES | Cc1cccc(NCc2nnnn2-c2ccc(C(F)(F)F)cc2)c1C(N)=O |
| InChI | InChI=1S/C17H15F3N6O/c1-10-3-2-4-13(15(10)16(21)27)22-9-14-23-24-25-26(14)12-7-5-11(6-8-12)17(18,19)20/h2-8,22H,9H2,1H3,(H2,21,27) |
| InChIKey | UPZLXVATWMUEHZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |