C16H16FN5O2S — CID 47068674
5-fluoro-2-methyl-N-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]aniline (PubChem CID 47068674) has the molecular formula C16H16FN5O2S and a molecular weight of 361.40 g/mol. Its IUPAC name is 5-fluoro-2-methyl-N-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]aniline.
| Compound Name | 5-fluoro-2-methyl-N-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]aniline |
|---|---|
| PubChem CID | 47068674 |
| Molecular Formula | C16H16FN5O2S |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 5-fluoro-2-methyl-N-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methyl]aniline |
| SMILES | Cc1ccc(F)cc1NCc1nnnn1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H16FN5O2S/c1-11-3-4-12(17)9-15(11)18-10-16-19-20-21-22(16)13-5-7-14(8-6-13)25(2,23)24/h3-9,18H,10H2,1-2H3 |
| InChIKey | DILJYRSXGGVWEH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |