C22H20N6O3S — CID 56504121
2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylamino]-N-phenylbenzamide (PubChem CID 56504121) has the molecular formula C22H20N6O3S and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylamino]-N-phenylbenzamide.
| Compound Name | 2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 56504121 |
| Molecular Formula | C22H20N6O3S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 2-[[1-(4-methylsulfonylphenyl)tetrazol-5-yl]methylamino]-N-phenylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(-n2nnnc2CNc2ccccc2C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H20N6O3S/c1-32(30,31)18-13-11-17(12-14-18)28-21(25-26-27-28)15-23-20-10-6-5-9-19(20)22(29)24-16-7-3-2-4-8-16/h2-14,23H,15H2,1H3,(H,24,29) |
| InChIKey | VIGRODGRKWRLNF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |