C13H13F3N2O3 — CID 62478264
5-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 62478264) has the molecular formula C13H13F3N2O3 and a molecular weight of 302.25 g/mol. Its IUPAC name is 5-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 5-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 62478264 |
| Molecular Formula | C13H13F3N2O3 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-(2-methoxyethyl)-3-[4-(trifluoromethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | COCCC1NC(=O)N(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C13H13F3N2O3/c1-21-7-6-10-11(19)18(12(20)17-10)9-4-2-8(3-5-9)13(14,15)16/h2-5,10H,6-7H2,1H3,(H,17,20) |
| InChIKey | NGSFYGIWFMGNKN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|