C14H15F3N2O4S — CID 40880325
(5R)-5-(2-methylsulfonylethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 40880325) has the molecular formula C14H15F3N2O4S and a molecular weight of 364.35 g/mol. Its IUPAC name is (5R)-5-(2-methylsulfonylethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-methylsulfonylethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40880325 |
| Molecular Formula | C14H15F3N2O4S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | (5R)-5-(2-methylsulfonylethyl)-3-[[4-(trifluoromethyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)CC[C@H]1NC(=O)N(Cc2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C14H15F3N2O4S/c1-24(22,23)7-6-11-12(20)19(13(21)18-11)8-9-2-4-10(5-3-9)14(15,16)17/h2-5,11H,6-8H2,1H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | FHLJJOUBYOYJAC-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|