C17H19N3O4S2 — CID 40751131
(5S)-3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione (PubChem CID 40751131) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (5S)-3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40751131 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (5S)-3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CN3C(=O)N[C@@H](CCS(C)(=O)=O)C3=O)cs2)cc1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-11-3-5-12(6-4-11)15-18-13(10-25-15)9-20-16(21)14(19-17(20)22)7-8-26(2,23)24/h3-6,10,14H,7-9H2,1-2H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | AGNIUEWNLAXXBP-AWEZNQCLSA-N |
| XLogP | 1.97 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|