C14H16N2O5S — CID 9166115
(5R)-5-(2-methylsulfonylethyl)-3-phenacylimidazolidine-2,4-dione (PubChem CID 9166115) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is (5R)-5-(2-methylsulfonylethyl)-3-phenacylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(2-methylsulfonylethyl)-3-phenacylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9166115 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | (5R)-5-(2-methylsulfonylethyl)-3-phenacylimidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)CC[C@H]1NC(=O)N(CC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C14H16N2O5S/c1-22(20,21)8-7-11-13(18)16(14(19)15-11)9-12(17)10-5-3-2-4-6-10/h2-6,11H,7-9H2,1H3,(H,15,19)/t11-/m1/s1 |
| InChIKey | MWCJGYJQENILCP-LLVKDONJSA-N |
| XLogP | 0.22 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|