C20H23N3O5S — CID 51563263
2-[(4R)-4-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 51563263) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-[(4R)-4-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-[(4R)-4-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 51563263 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-[(4R)-4-(2-methylsulfonylethyl)-2,5-dioxoimidazolidin-1-yl]-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)N[C@H](CCS(C)(=O)=O)C1=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H23N3O5S/c1-13(15-8-7-14-5-3-4-6-16(14)11-15)21-18(24)12-23-19(25)17(22-20(23)26)9-10-29(2,27)28/h3-8,11,13,17H,9-10,12H2,1-2H3,(H,21,24)(H,22,26)/t13-,17+/m0/s1 |
| InChIKey | FTXCDDZVRDXJQS-SUMWQHHRSA-N |
| XLogP | 1.37 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|