C17H24N2O4S — CID 40751097
(5S)-3-[(4-tert-butylphenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione (PubChem CID 40751097) has the molecular formula C17H24N2O4S and a molecular weight of 352.46 g/mol. Its IUPAC name is (5S)-3-[(4-tert-butylphenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(4-tert-butylphenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40751097 |
| Molecular Formula | C17H24N2O4S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (5S)-3-[(4-tert-butylphenyl)methyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)c1ccc(CN2C(=O)N[C@@H](CCS(C)(=O)=O)C2=O)cc1 |
| InChI | InChI=1S/C17H24N2O4S/c1-17(2,3)13-7-5-12(6-8-13)11-19-15(20)14(18-16(19)21)9-10-24(4,22)23/h5-8,14H,9-11H2,1-4H3,(H,18,21)/t14-/m0/s1 |
| InChIKey | AJGSGIGHNHUSOE-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|