C13H17N3O2 — CID 93320116
(5S)-3-(4-aminophenyl)-5-(2-methylpropyl)imidazolidine-2,4-dione (PubChem CID 93320116) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (5S)-3-(4-aminophenyl)-5-(2-methylpropyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(4-aminophenyl)-5-(2-methylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 93320116 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (5S)-3-(4-aminophenyl)-5-(2-methylpropyl)imidazolidine-2,4-dione |
| SMILES | CC(C)C[C@@H]1NC(=O)N(c2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C13H17N3O2/c1-8(2)7-11-12(17)16(13(18)15-11)10-5-3-9(14)4-6-10/h3-6,8,11H,7,14H2,1-2H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | RGEBQNNRHDAMNA-NSHDSACASA-N |
| XLogP | 1.74 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|