C12H15Cl2N3O2 — CID 44604673
3-(4-chlorophenyl)-5-[(dimethylamino)methyl]imidazolidine-2,4-dione;hydrochloride (PubChem CID 44604673) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(dimethylamino)methyl]imidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-(4-chlorophenyl)-5-[(dimethylamino)methyl]imidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 44604673 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(dimethylamino)methyl]imidazolidine-2,4-dione;hydrochloride |
| SMILES | CN(C)CC1NC(=O)N(c2ccc(Cl)cc2)C1=O.Cl |
| InChI | InChI=1S/C12H14ClN3O2.ClH/c1-15(2)7-10-11(17)16(12(18)14-10)9-5-3-8(13)4-6-9;/h3-6,10H,7H2,1-2H3,(H,14,18);1H |
| InChIKey | BRYRVQZEGLUUHP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|