C11H8ClN2O4- — CID 4062868
2-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]acetate (PubChem CID 4062868) has the molecular formula C11H8ClN2O4- and a molecular weight of 267.65 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]acetate.
| Compound Name | 2-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 4062868 |
| Molecular Formula | C11H8ClN2O4- |
| Molecular Weight | 267.65 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 2-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]acetate |
| SMILES | O=C([O-])CC1NC(=O)N(c2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C11H9ClN2O4/c12-6-1-3-7(4-2-6)14-10(17)8(5-9(15)16)13-11(14)18/h1-4,8H,5H2,(H,13,18)(H,15,16)/p-1 |
| InChIKey | UDOPITICNQWATG-UHFFFAOYSA-M |
| XLogP | -0.10 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.65 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|