C17H21ClN4O3 — CID 119514778
3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(pyrrolidin-2-ylmethyl)propanamide (PubChem CID 119514778) has the molecular formula C17H21ClN4O3 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(pyrrolidin-2-ylmethyl)propanamide.
| Compound Name | 3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(pyrrolidin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 119514778 |
| Molecular Formula | C17H21ClN4O3 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 3-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]-N-(pyrrolidin-2-ylmethyl)propanamide |
| SMILES | O=C(CCC1NC(=O)N(c2ccc(Cl)cc2)C1=O)NCC1CCCN1 |
| InChI | InChI=1S/C17H21ClN4O3/c18-11-3-5-13(6-4-11)22-16(24)14(21-17(22)25)7-8-15(23)20-10-12-2-1-9-19-12/h3-6,12,14,19H,1-2,7-10H2,(H,20,23)(H,21,25) |
| InChIKey | WTJVSWMSVUQKSC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|