C13H11ClN4O2 — CID 15120611
(5R)-3-(4-chlorophenyl)-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione (PubChem CID 15120611) has the molecular formula C13H11ClN4O2 and a molecular weight of 290.71 g/mol. Its IUPAC name is (5R)-3-(4-chlorophenyl)-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(4-chlorophenyl)-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 15120611 |
| Molecular Formula | C13H11ClN4O2 |
| Molecular Weight | 290.71 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | (5R)-3-(4-chlorophenyl)-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2cnc[nH]2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClN4O2/c14-8-1-3-10(4-2-8)18-12(19)11(17-13(18)20)5-9-6-15-7-16-9/h1-4,6-7,11H,5H2,(H,15,16)(H,17,20)/t11-/m1/s1 |
| InChIKey | JFQYUEFDLDSJEI-LLVKDONJSA-N |
| XLogP | 1.73 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|