C11H10N4O2S — CID 102323017
(5S)-5-(1H-imidazol-5-ylmethyl)-3-thiophen-3-ylimidazolidine-2,4-dione (PubChem CID 102323017) has the molecular formula C11H10N4O2S and a molecular weight of 262.29 g/mol. Its IUPAC name is (5S)-5-(1H-imidazol-5-ylmethyl)-3-thiophen-3-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-5-(1H-imidazol-5-ylmethyl)-3-thiophen-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 102323017 |
| Molecular Formula | C11H10N4O2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | (5S)-5-(1H-imidazol-5-ylmethyl)-3-thiophen-3-ylimidazolidine-2,4-dione |
| SMILES | O=C1N[C@@H](Cc2cnc[nH]2)C(=O)N1c1ccsc1 |
| InChI | InChI=1S/C11H10N4O2S/c16-10-9(3-7-4-12-6-13-7)14-11(17)15(10)8-1-2-18-5-8/h1-2,4-6,9H,3H2,(H,12,13)(H,14,17)/t9-/m0/s1 |
| InChIKey | JKCAGDUFIDHQAQ-VIFPVBQESA-N |
| XLogP | 1.14 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|