C21H20N4O2 — CID 15120618
(5R)-3-[(1S)-1,2-diphenylethyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione (PubChem CID 15120618) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (5R)-3-[(1S)-1,2-diphenylethyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-3-[(1S)-1,2-diphenylethyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 15120618 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (5R)-3-[(1S)-1,2-diphenylethyl]-5-(1H-imidazol-5-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@H](Cc2cnc[nH]2)C(=O)N1[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N4O2/c26-20-18(12-17-13-22-14-23-17)24-21(27)25(20)19(16-9-5-2-6-10-16)11-15-7-3-1-4-8-15/h1-10,13-14,18-19H,11-12H2,(H,22,23)(H,24,27)/t18-,19+/m1/s1 |
| InChIKey | JJXSOAIDDQAGJA-MOPGFXCFSA-N |
| XLogP | 2.86 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|