C17H20N4O2 — CID 5323610
3-(1H-imidazol-5-ylmethyl)-6-(2-phenylpropan-2-yl)piperazine-2,5-dione (PubChem CID 5323610) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-(1H-imidazol-5-ylmethyl)-6-(2-phenylpropan-2-yl)piperazine-2,5-dione.
| Compound Name | 3-(1H-imidazol-5-ylmethyl)-6-(2-phenylpropan-2-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 5323610 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(1H-imidazol-5-ylmethyl)-6-(2-phenylpropan-2-yl)piperazine-2,5-dione |
| SMILES | CC(C)(c1ccccc1)C1NC(=O)C(Cc2cnc[nH]2)NC1=O |
| InChI | InChI=1S/C17H20N4O2/c1-17(2,11-6-4-3-5-7-11)14-16(23)20-13(15(22)21-14)8-12-9-18-10-19-12/h3-7,9-10,13-14H,8H2,1-2H3,(H,18,19)(H,20,23)(H,21,22) |
| InChIKey | PQYNAABAKRNLRW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |