C16H18N4O2 — CID 11087822
(3S,6S)-3-benzyl-6-(1H-imidazol-5-ylmethyl)-3-methylpiperazine-2,5-dione (PubChem CID 11087822) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (3S,6S)-3-benzyl-6-(1H-imidazol-5-ylmethyl)-3-methylpiperazine-2,5-dione.
| Compound Name | (3S,6S)-3-benzyl-6-(1H-imidazol-5-ylmethyl)-3-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 11087822 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (3S,6S)-3-benzyl-6-(1H-imidazol-5-ylmethyl)-3-methylpiperazine-2,5-dione |
| SMILES | C[C@@]1(Cc2ccccc2)NC(=O)[C@H](Cc2cnc[nH]2)NC1=O |
| InChI | InChI=1S/C16H18N4O2/c1-16(8-11-5-3-2-4-6-11)15(22)19-13(14(21)20-16)7-12-9-17-10-18-12/h2-6,9-10,13H,7-8H2,1H3,(H,17,18)(H,19,22)(H,20,21)/t13-,16-/m0/s1 |
| InChIKey | CHFYPXPAMAQQEH-BBRMVZONSA-N |
| XLogP | 0.57 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |