C18H24N8O4 — CID 170676916
trans-(3S,10S)-3,10-bis(1H-imidazol-5-ylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone (PubChem CID 170676916) has the molecular formula C18H24N8O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is trans-(3S,10S)-3,10-bis(1H-imidazol-5-ylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone.
| Compound Name | trans-(3S,10S)-3,10-bis(1H-imidazol-5-ylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 170676916 |
| Molecular Formula | C18H24N8O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | trans-(3S,10S)-3,10-bis(1H-imidazol-5-ylmethyl)-1,4,8,11-tetrazacyclotetradecane-2,5,9,12-tetrone |
| SMILES | O=C1CCNC(=O)[C@H](Cc2cnc[nH]2)NC(=O)CCNC(=O)[C@H](Cc2cnc[nH]2)N1 |
| InChI | InChI=1S/C18H24N8O4/c27-15-1-3-21-17(29)14(6-12-8-20-10-24-12)26-16(28)2-4-22-18(30)13(25-15)5-11-7-19-9-23-11/h7-10,13-14H,1-6H2,(H,19,23)(H,20,24)(H,21,29)(H,22,30)(H,25,27)(H,26,28)/t13-,14-/m0/s1 |
| InChIKey | YTQUMMCJSUISRY-KBPBESRZSA-N |
| XLogP | -2.09 |
| TPSA | 173.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |