C17H17N5O2 — CID 102308600
(3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-(1H-indol-2-ylmethyl)piperazine-2,5-dione (PubChem CID 102308600) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-(1H-indol-2-ylmethyl)piperazine-2,5-dione.
| Compound Name | (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-(1H-indol-2-ylmethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 102308600 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3S,6S)-3-(1H-imidazol-5-ylmethyl)-6-(1H-indol-2-ylmethyl)piperazine-2,5-dione |
| SMILES | O=C1N[C@@H](Cc2cc3ccccc3[nH]2)C(=O)N[C@H]1Cc1cnc[nH]1 |
| InChI | InChI=1S/C17H17N5O2/c23-16-14(6-11-5-10-3-1-2-4-13(10)20-11)21-17(24)15(22-16)7-12-8-18-9-19-12/h1-5,8-9,14-15,20H,6-7H2,(H,18,19)(H,21,24)(H,22,23)/t14-,15-/m0/s1 |
| InChIKey | CUJPKWWZTNKVLH-GJZGRUSLSA-N |
| XLogP | 0.66 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |