C13H13N3O2 — CID 177371446
(3R)-3-(1H-indol-2-ylmethyl)piperazine-2,6-dione (PubChem CID 177371446) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (3R)-3-(1H-indol-2-ylmethyl)piperazine-2,6-dione.
| Compound Name | (3R)-3-(1H-indol-2-ylmethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 177371446 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (3R)-3-(1H-indol-2-ylmethyl)piperazine-2,6-dione |
| SMILES | O=C1CN[C@H](Cc2cc3ccccc3[nH]2)C(=O)N1 |
| InChI | InChI=1S/C13H13N3O2/c17-12-7-14-11(13(18)16-12)6-9-5-8-3-1-2-4-10(8)15-9/h1-5,11,14-15H,6-7H2,(H,16,17,18)/t11-/m1/s1 |
| InChIKey | SJZZJVUINDAWJS-LLVKDONJSA-N |
| XLogP | 0.32 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|