C13H12N4O4 — CID 118541130
5-(hydroxyamino)-5-(1H-indol-2-ylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 118541130) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 5-(hydroxyamino)-5-(1H-indol-2-ylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(hydroxyamino)-5-(1H-indol-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118541130 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 5-(hydroxyamino)-5-(1H-indol-2-ylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(Cc2cc3ccccc3[nH]2)(NO)C(=O)N1 |
| InChI | InChI=1S/C13H12N4O4/c18-10-13(17-21,11(19)16-12(20)15-10)6-8-5-7-3-1-2-4-9(7)14-8/h1-5,14,17,21H,6H2,(H2,15,16,18,19,20) |
| InChIKey | PJRKHJIQAGFQMD-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|