C10H10N2O — CID 54534530
N-(1H-indol-2-ylmethyl)formamide (PubChem CID 54534530) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is N-(1H-indol-2-ylmethyl)formamide.
| Compound Name | N-(1H-indol-2-ylmethyl)formamide |
|---|---|
| PubChem CID | 54534530 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | N-(1H-indol-2-ylmethyl)formamide |
| SMILES | O=CNCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H10N2O/c13-7-11-6-9-5-8-3-1-2-4-10(8)12-9/h1-5,7,12H,6H2,(H,11,13) |
| InChIKey | DTBDZDXHJOAQNV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|