C11H11F3N2 — CID 62095860
2,2,2-trifluoro-N-(1H-indol-2-ylmethyl)ethanamine (PubChem CID 62095860) has the molecular formula C11H11F3N2 and a molecular weight of 228.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(1H-indol-2-ylmethyl)ethanamine.
| Compound Name | 2,2,2-trifluoro-N-(1H-indol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62095860 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2,2,2-trifluoro-N-(1H-indol-2-ylmethyl)ethanamine |
| SMILES | FC(F)(F)CNCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C11H11F3N2/c12-11(13,14)7-15-6-9-5-8-3-1-2-4-10(8)16-9/h1-5,15-16H,6-7H2 |
| InChIKey | BUSZNXRBCYUZEG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |