C19H19F3N4 — CID 111421271
1-(1H-indol-2-ylmethyl)-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111421271) has the molecular formula C19H19F3N4 and a molecular weight of 360.38 g/mol. Its IUPAC name is 1-(1H-indol-2-ylmethyl)-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111421271 |
| Molecular Formula | C19H19F3N4 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(C(F)(F)F)cc1)NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H19F3N4/c1-23-18(24-11-13-6-8-15(9-7-13)19(20,21)22)25-12-16-10-14-4-2-3-5-17(14)26-16/h2-10,26H,11-12H2,1H3,(H2,23,24,25) |
| InChIKey | LSHYSMIMVKCLOB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|