C17H19N5 — CID 110968674
1-(1H-indol-2-ylmethyl)-2-methyl-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110968674) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(1H-indol-2-ylmethyl)-2-methyl-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110968674 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 1-(1H-indol-2-ylmethyl)-2-methyl-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccccn1)NCc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H19N5/c1-18-17(20-11-14-7-4-5-9-19-14)21-12-15-10-13-6-2-3-8-16(13)22-15/h2-10,22H,11-12H2,1H3,(H2,18,20,21) |
| InChIKey | HRTVJIHMWJVGBD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|