C21H26N4 — CID 172594297
N-(1H-indol-2-ylmethyl)-2-(4-phenylpiperazin-1-yl)ethanamine (PubChem CID 172594297) has the molecular formula C21H26N4 and a molecular weight of 334.47 g/mol. Its IUPAC name is N-(1H-indol-2-ylmethyl)-2-(4-phenylpiperazin-1-yl)ethanamine.
| Compound Name | N-(1H-indol-2-ylmethyl)-2-(4-phenylpiperazin-1-yl)ethanamine |
|---|---|
| PubChem CID | 172594297 |
| Molecular Formula | C21H26N4 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.22 |
| IUPAC Name | N-(1H-indol-2-ylmethyl)-2-(4-phenylpiperazin-1-yl)ethanamine |
| SMILES | c1ccc(N2CCN(CCNCc3cc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C21H26N4/c1-2-7-20(8-3-1)25-14-12-24(13-15-25)11-10-22-17-19-16-18-6-4-5-9-21(18)23-19/h1-9,16,22-23H,10-15,17H2 |
| InChIKey | HUWUJRWPWDFWTI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|