C25H33ClN4O — CID 145370719
1-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-4-(1H-indol-2-ylmethylamino)butan-2-ol (PubChem CID 145370719) has the molecular formula C25H33ClN4O and a molecular weight of 441.02 g/mol. Its IUPAC name is 1-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-4-(1H-indol-2-ylmethylamino)butan-2-ol.
| Compound Name | 1-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-4-(1H-indol-2-ylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 145370719 |
| Molecular Formula | C25H33ClN4O |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 1-[4-(2-chloro-3-ethylphenyl)piperazin-1-yl]-4-(1H-indol-2-ylmethylamino)butan-2-ol |
| SMILES | CCc1cccc(N2CCN(CC(O)CCNCc3cc4ccccc4[nH]3)CC2)c1Cl |
| InChI | InChI=1S/C25H33ClN4O/c1-2-19-7-5-9-24(25(19)26)30-14-12-29(13-15-30)18-22(31)10-11-27-17-21-16-20-6-3-4-8-23(20)28-21/h3-9,16,22,27-28,31H,2,10-15,17-18H2,1H3 |
| InChIKey | KXAGHJFFKZDPGM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|