C20H24N4 — CID 111087898
1-(2,6-diethylphenyl)-2-(1H-indol-2-ylmethyl)guanidine (PubChem CID 111087898) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-2-(1H-indol-2-ylmethyl)guanidine.
| Compound Name | 1-(2,6-diethylphenyl)-2-(1H-indol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111087898 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(2,6-diethylphenyl)-2-(1H-indol-2-ylmethyl)guanidine |
| SMILES | CCc1cccc(CC)c1N/C(N)=N/Cc1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H24N4/c1-3-14-9-7-10-15(4-2)19(14)24-20(21)22-13-17-12-16-8-5-6-11-18(16)23-17/h5-12,23H,3-4,13H2,1-2H3,(H3,21,22,24) |
| InChIKey | AKSGWJNJRMXKQS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|