C19H20N4 — CID 111087924
1-(2,3-dihydro-1H-inden-5-yl)-2-(1H-indol-2-ylmethyl)guanidine (PubChem CID 111087924) has the molecular formula C19H20N4 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-(1H-indol-2-ylmethyl)guanidine.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(1H-indol-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111087924 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-(1H-indol-2-ylmethyl)guanidine |
| SMILES | N/C(=N\Cc1cc2ccccc2[nH]1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H20N4/c20-19(23-16-9-8-13-5-3-6-14(13)10-16)21-12-17-11-15-4-1-2-7-18(15)22-17/h1-2,4,7-11,22H,3,5-6,12H2,(H3,20,21,23) |
| InChIKey | USPKADZAMHYNJG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|