C21H23BrN4O — CID 154806562
1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-methyl-2-oxoquinolin-3-yl)methyl]guanidine;hydrobromide (PubChem CID 154806562) has the molecular formula C21H23BrN4O and a molecular weight of 427.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-methyl-2-oxoquinolin-3-yl)methyl]guanidine;hydrobromide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-methyl-2-oxoquinolin-3-yl)methyl]guanidine;hydrobromide |
|---|---|
| PubChem CID | 154806562 |
| Molecular Formula | C21H23BrN4O |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[(1-methyl-2-oxoquinolin-3-yl)methyl]guanidine;hydrobromide |
| SMILES | Br.Cn1c(=O)c(C/N=C(\N)Nc2ccc3c(c2)CCC3)cc2ccccc21 |
| InChI | InChI=1S/C21H22N4O.BrH/c1-25-19-8-3-2-5-16(19)11-17(20(25)26)13-23-21(22)24-18-10-9-14-6-4-7-15(14)12-18;/h2-3,5,8-12H,4,6-7,13H2,1H3,(H3,22,23,24);1H |
| InChIKey | CETATOPYHVCBJV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|